LN-627381
3-HYDROXY DESLORATADINE HCL , 97% , 119410-08-1
CAS NO.：119410-08-1
Empirical Formula: C19H19ClN2O
Molecular Weight: 326.82
MDL number: MFCD00878381
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 169-171°C |
| Boiling point: | 575.2±50.0 °C(Predicted) |
| Density | 1.292 |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | DMF: 10 mg/ml; DMF:PBS(pH 7.2)(1:6): 0.14 mg/ml; DMSO: 10 mg/ml; Ethanol: 5 mg/ml |
| form | A crystalline solid |
| pka | 9.27±0.20(Predicted) |
| color | pale yellow to off-white |
| InChI | 1S/C19H19ClN2O/c20-15-3-4-17-13(9-15)1-2-14-10-16(23)11-22-19(14)18(17)12-5-7-21-8-6-12/h3-4,9-11,21,23H,1-2,5-8H2 |
| InChIKey | NDFMTPISBHBIKE-UHFFFAOYSA-N |
| SMILES | Clc1cc2c(cc1)C(=C4CCNCC4)c3ncc(cc3CC2)O |
Description and Uses
3-Hydroxy Desloratadine is an active metabolite of Loratadine.
Safety
| Symbol(GHS) |    GHS07,GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H411-H318 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P305+P351+P338-P310 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
