LN-992326
METRAFENONE , 98% , 220899-03-6
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 534.4±50.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| Major Application | agriculture environmental |
| InChI | 1S/C19H21BrO5/c1-10-9-14(23-4)18(24-5)19(25-6)15(10)17(21)16-11(2)12(20)7-8-13(16)22-3/h7-9H,1-6H3 |
| InChIKey | AMSPWOYQQAWRRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c(C)c1C(=O)c2c(C)cc(OC)c(OC)c2OC |
| LogP | 5.190 (est) |
| EPA Substance Registry System | Methanone, (3-bromo-6-methoxy-2-methylphenyl)(2,3,4-trimethoxy-6-methylphenyl)- (220899-03-6) |
Description and Uses
Metrafenone is a fungicide used in pesticide formulations in the protection of vegetation and crops.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
