LN-992732
PROPIONIC ACID-D5 , 98% HPLC , 60153-92-6
Update time: 2023-04-23
PRODUCT Properties
| Density | 1.059 g/mL at 25 °C |
| Flash point: | 54°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Boiling point: | 141°C(lit.) |
| InChI | InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) |
| InChIKey | XBDQKXXYIPTUBI-UHFFFAOYSA-N |
| SMILES | C(=O)(O)C([H])([H])C([H])([H])[H] |
| CAS Number Unlabeled | 79-09-4 |
Description and Uses
(Propanoic-d5 acid) Labeled propanoic acid, intended for use as an internal standard for the quantification of propanoic acid by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) | ![]() ![]() GHS02, GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P403+P235 |
| target organs | Respiratory system |
| RIDADR | UN3463 - class 3 - Propionic acid |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B STOT SE 3 |







