LN0837727
≥95% , 1717-42-6
Synonym(s):
3-(3-Trifluoromethylphenyl)-3-oxo-propionic acid ethyl ester;Ethyl 2-(3-trifluoromethylbenzoyl)acetate;Ethyl 3-(3-trifluoromethylphenyl)-3-oxopropanoate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB4400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 250-251 °C (lit.) |
| Density | 1.267 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| pka | 9.61±0.46(Predicted) |
| form | liquid |
| InChI | 1S/C12H11F3O3/c1-2-18-11(17)7-10(16)8-4-3-5-9(6-8)12(13,14)15/h3-6H,2,7H2,1H3 |
| InChIKey | YCHPVUWFIZXXPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(c1)C(F)(F)F |
| CAS DataBase Reference | 1717-42-6(CAS DataBase Reference) |
Description and Uses
Reactant for:• ;Preparation of pyrido[1,2-a]benzimidazoles as cytotoxic and antiplasmodial agent1• ;Preparation of diaryl-substituted pyrazoles as potent CCR2 receptor antagonists2• ;Acid-catalyzed addition/annulation reactions3• ;Cyclocondensation with diaminophenylpyrazole4
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Storage Class | 10 - Combustible liquids |






