LN1045527
≥95% , 84467-54-9
| Pack Size | Price | Stock | Quantity |
| 0.25g | RMB2800.00 | In Stock |
|
| 1g | RMB6800.00 | In Stock |
|
| 5g | RMB11600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 337.9±25.0 °C(Predicted) |
| Density | 1.072±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 10.82±0.42(Predicted) |
| form | Oil |
| color | Clear Colourless |
| InChI | InChI=1S/C15H22ClN/c1-11(2)10-14(17)15(8-3-9-15)12-4-6-13(16)7-5-12/h4-7,11,14H,3,8-10,17H2,1-2H3 |
| InChIKey | WQSACWZKKZPCHN-UHFFFAOYSA-N |
| SMILES | C1(CCC1)(C1=CC=C(C=C1)Cl)C(N)CC(C)C |
Description and Uses
A metabolite of Sibutramine, a serotonin and noradrenaline reuptake inhibitor (SNR). Decreases calorie intake and increases energy expenditure.



