PRODUCT Properties
| Melting point: | 67 °C |
| Boiling point: | 123 °C |
| Density | 1.718±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 0.52±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H2F16O2/c10-1(11)3(12,13)5(16,17)7(20,21)9(24,25)8(22,23)6(18,19)4(14,15)2(26)27/h1H,(H,26,27) |
| InChIKey | RARQGXBOCXOJPM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| CAS DataBase Reference | 76-21-1(CAS DataBase Reference) |
| EPA Substance Registry System | 9-H-Perfluorononanoic acid (76-21-1) |
Description and Uses
9H-Hexadecafluorononanoic Acid can be used to remove fluorine-containing compound from wastewater using adsorbent.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P310-P260-P280 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3261 |
| HazardClass | CORROSIVE |
| HS Code | 2915907098 |
