LN2267139
98% , 4887-42-7
CAS NO.:4887-42-7
Empirical Formula: C9H11NO3
Molecular Weight: 181.19
MDL number: MFCD00051728
EINECS: 225-500-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB288.00 | In Stock |
|
| 250mg | RMB480.00 | In Stock |
|
| 1g | RMB959.20 | In Stock |
|
| 5g | RMB1556.00 | In Stock |
|
| 10g | RMB2368.00 | In Stock |
|
| 25g | RMB3980.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-85 °C(lit.) |
| Boiling point: | 314.29°C (rough estimate) |
| Density | 1.2375 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| pka | 13.42±0.10(Predicted) |
| InChI | InChI=1S/C9H11NO3/c11-5-10-8(12)6-3-1-2-4-7(6)9(10)13/h11H,1-5H2 |
| InChIKey | QQHOVRKETYPQHY-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(CCCC2)C(=O)N1CO |
| CAS DataBase Reference | 4887-42-7(CAS DataBase Reference) |
Description and Uses
N-hydroxymethyl-3,4,5,6-tetrahydrophthalimide (abbreviated as amino alcohol) is an important intermediate of the sanitary insecticide pyrethroid.






![1-[(2-Chlorophenyl)(methylimino)methyl]cyclopentanolHydrochloride](https://img.chemicalbook.com/CAS/GIF/90717-16-1.gif)