LN2363639
98% , 61643-23-0
CAS NO.：61643-23-0
Empirical Formula: C12H9F3N2O2
Molecular Weight: 270.21
MDL number: MFCD05741084
EINECS: 642-277-6
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1587.20 | In Stock |
|
| 10mg | RMB2886.40 | In Stock |
|
| 25mg | RMB5248.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106 - 110℃ |
| Boiling point: | 285.0±40.0 °C(Predicted) |
| Density | 1.392±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.62±0.70(Predicted) |
| color | White to Off-White |
| BRN | 1083122 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C12H9F3N2O2/c1-7-10(6-16-19-7)11(18)17-9-4-2-3-8(5-9)12(13,14)15/h2-6H,1H3,(H,17,18) |
| InChIKey | KBFQQKBZIFSAMY-UHFFFAOYSA-N |
| SMILES | O=C(C1=C(C)ON=C1)NC2=CC=CC(C(F)(F)F)=C2 |
Description and Uses
Leflunomide 3-Isomer (Leflunomide EP Impurity C) is a Leflunomide analogue, with potential antiinflammatory and anti-viral activity. Leflunomide (L322750) Impurity E.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2934990002 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
