LN2959049
ProstaglandinF2αmethylester , ≥98% , 33854-16-9
CAS NO.：33854-16-9
Empirical Formula: C21H36O5
Molecular Weight: 368.51
MDL number: MFCD00133790
EINECS: 201-185-2
| Pack Size | Price | Stock | Quantity |
| 500ug | RMB328.00 | In Stock |
|
| 1mg | RMB628.00 | In Stock |
|
| 5mg | RMB2352.00 | In Stock |
|
| 10mg | RMB4116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 418.83°C (rough estimate) |
| Density | 1.0390 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| Flash point: | -9 °C |
| storage temp. | −20°C |
| solubility | DMF: 35 mg/ml; DMSO: 35 mg/ml; Ethanol: 50 mg/ml; Ethanol:PBS (pH 7.2) (1:4): 0.4 mg/ml |
| InChIKey | KRDFNHLEMLCWKD-GWSKAPOCSA-N |
| SMILES | CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(=O)OCC |
Description and Uses
Prostaglandin F2α methyl ester (PGF2α methyl ester; Dinoprost methyl) is a PGF2α analog with more lipid solubility. Prostaglandin F2α methyl ester exhibits efficacy in maintaining the ocular hypotensive[1].
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319-H336 |
| Precautionary statements | P210-P305+P351+P338 |
| target organs | Central nervous system |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36-66-67 |
| Safety Statements | 16-26-29-33 |
| RIDADR | UN 1231 3/PG 2 |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
