LN3072349
11β-ProstaglandinF2αMaxSpec?Standard , ≥98% , 38432-87-0
| Pack Size | Price | Stock | Quantity |
| 100ug | RMB1908.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 531.0±50.0 °C(Predicted) |
| Density | 1.153±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF: 100 mg/ml,DMSO: 100 mg/ml,Ethanol: 100 mg/ml,PBS pH 7.2: 10 mg/ml |
| pka | 4.76±0.10(Predicted) |
| form | powder |
| InChIKey | PXGPLTODNUVGFL-ZWAKLXPCSA-N |
| SMILES | O[C@H]1C[C@H](O)[C@H](C/C=C\CCCC(O)=O)[C@H]1/C=C/[C@@H](O)CCCCC |
Description and Uses
9alpha,11beta-PGF2 (9alpha,11beta-Prostaglandin F2) is platelet aggregation and adipose differentiation inhibitor.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Repr. 1B |






