AvantiPolarLipids900105P,ProstaglandinF1α,powder , 745-62-0
Synonym(s):
Prostaglandin F1α
CAS NO.:745-62-0
Empirical Formula: C20H36O5
Molecular Weight: 356.5
MDL number: MFCD00077862
EINECS: 234-237-8
| Pack Size | Price | Stock | Quantity |
| 1mg | RMB534.10 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 102.5°C |
| Boiling point: | 409.31°C (rough estimate) |
| alpha | +24°(D/24℃)(c=0.87,THF) |
| Density | 1.0321 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | -20°C |
| solubility | DMF: 50 mg/ml; DMSO: 50 mg/ml; Ethanol: 50 mg/ml; PBS pH 7.2: 2 mg/ml |
| form | A crystalline solid |
| pka | 4.78±0.10(Predicted) |
| color | White to off-white |
| BRN | 2704846 |
| InChI | 1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | DZUXGQBLFALXCR-CDIPTNKSSA-N |
| SMILES | O[C@@H]1[C@H](CCCCCCC(O)=O)[C@@H](/C=C/[C@H](CCCCC)O)[C@H](O)C1 |
Description and Uses
Prostaglandin F1α (PGF1α) is the putative metabolite of dihomo-
PGF1alpha (Prostaglandin F1alpha) is a smooth muscle relaxant and a stable metabolite of prostacyclin (PGI2).





