PRODUCT Properties
| Boiling point: | 102-103 °C(Press: 12 Torr) |
| Density | 1.131 g/mL at 25 °C (lit.) |
| vapor pressure | 0.36 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Storage temp. 2-8°C |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C6H8N2O3/c1-3-11-6(10)5(8-7)4(2)9/h3H2,1-2H3 |
| InChIKey | JWTPSIXYXYNAOU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(C)=O |
Description and Uses
Ethyl diazoacetoacetate can be used as a reactant to synthesize:
- 1,4-oxathiocines and thiopyran derivatives via Rh-catalyzed reaction with 2-amino-4,5-dihydro-3-thiophenecarbonitriles.
- β-keto esters via C-H insertion reaction with aromatic aldehydes using NbCl5 as a catalyst.
- Diazoacetoacetate derivatives by reacting with aldehydes via aldol condensation and subsequent and in situ oxidation reaction.
- Isoquinolone and pyridone derivatives by Rh-catalyzed C-H activation/annulation reaction with various N-methoxybenzamides.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H242-H315-H319-H335 |
| Precautionary statements | P210-P235-P302+P352-P305+P351+P338-P370+P378-P403+P233 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29270000 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Self-react. C Skin Irrit. 2 STOT SE 3 |






