LN3507441
1-(3-Trifluoromethyl)phenylpiperazine , 98% , 15532-75-9
CAS NO.：15532-75-9
Empirical Formula: C11H13F3N2
Molecular Weight: 230.23
MDL number: MFCD00005959
EINECS: 239-574-4
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100-102°C 0,1mm |
| Density | 1.226 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| pka | 8.88±0.10(Predicted) |
| form | liquid |
| Sensitive | Air Sensitive |
| BRN | 614217 |
| Major Application | forensics and toxicology |
| InChI | 1S/C11H13F3N2.ClH/c12-11(13,14)9-2-1-3-10(8-9)16-6-4-15-5-7-16;/h1-3,8,15H,4-7H2;1H/i4D2,7D2; |
| InChIKey | DGNLGWJZZZOYPT-DCZHHYCSSA-N |
| SMILES | Cl.[2H]C1([2H])CN(c2cccc(c2)C(F)(F)F)C([2H])([2H])CN1 |
| CAS DataBase Reference | 15532-75-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Piperazine, 1-[3-(trifluoromethyl)phenyl]-(15532-75-9) |
Description and Uses
1-[3-(Trifluoromethyl)phenyl]piperazine is used in preparation of (Piperazinylethyl)cyclohexanamide derivatives and used as treatment or prevention of D3 and/or 5HT-2 receptor diseases.
Safety
| Symbol(GHS) |     GHS05,GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370-H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a-P210-P260-P280-P301+P310-P311 |
| target organs | Eyes |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| RTECS | TM2820000 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29335995 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
