LN3692021
BR，99% , 3179-89-3
Synonym(s):
3-Methyl-4-(4′-nitrophenylazo)-N,N-bis(2-hydroxyethyl)aniline
CAS NO.：3179-89-3
Empirical Formula: C17H20N4O4
Molecular Weight: 344.37
MDL number: MFCD00071927
EINECS: 221-665-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB240.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160°C |
| Boiling point: | 479.47°C (rough estimate) |
| Density | 1.1561 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| pka | 14.26±0.10(Predicted) |
| Colour Index | 11210 |
| Water Solubility | 619.9ug/L(25 ºC) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C17H20N4O4/c1-13-12-16(20(8-10-22)9-11-23)6-7-17(13)19-18-14-2-4-15(5-3-14)21(24)25/h2-7,12,22-23H,8-11H2,1H3/b19-18+ |
| InChIKey | ADCWDMYESTYBBN-VHEBQXMUSA-N |
| SMILES | OCCN(CCO)C(C=C1C)=CC=C1/N=N/C2=CC=C([N+]([O-])=O)C=C2 |
| LogP | 3.450 (est) |
| EPA Substance Registry System | C.I. Disperse Red 17 (3179-89-3) |
Description and Uses
Disperse orange 3 is used as a dye in acetate, silk, wool, and cotton; stocking dye.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
