LN5471249
≥90% , 24720-09-0
CAS NO.:24720-09-0
Empirical Formula: C13H20O
Molecular Weight: 192.3
MDL number: MFCD00673214
EINECS: 246-430-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB289.60 | In Stock |
|
| 5g | RMB714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 267.1±29.0 °C(Predicted) |
| Density | 0.898±0.06 g/cm3(Predicted) |
| vapor pressure | 3.2Pa at 25℃ |
| FEMA | 4088 | TRANS-ALPHA-DAMASCONE |
| refractive index | n20/D 1.496 |
| Flash point: | 100 °C |
| Odor | at 1.00 % in dipropylene glycol. floral rose apple fruity black currant |
| Odor Type | fruity |
| Water Solubility | 140mg/L at 20℃ |
| JECFA Number | 2188 |
| Major Application | flavors and fragrances |
| InChIKey | CRIGTVCBMUKRSL-FNORWQNLSA-N |
| SMILES | C\C=C\C(=O)C1C(C)=CCCC1(C)C |
| LogP | 3.66 at 25℃ |
| EPA Substance Registry System | 2-Buten-1-one, 1-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, (2E)- (24720-09-0) |
Description and Uses
flavors and fragrances
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H302-H411 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1B |






![[1alpha(E),2beta]-1-(2,6,6-trimethylcyclohex-3-en-1-yl)but-2-en-1-one](https://img.chemicalbook.com/CAS/GIF/71048-82-3.gif)
