S681380
≥95%,sumofisomers,FG , 23726-91-2
Synonym(s):
(E)-1-(2,6,6-Trimethyl-1-cyclohexenyl)-2-buten-1-one
CAS NO.:23726-91-2
Empirical Formula: C13H20O
Molecular Weight: 192.3
MDL number: MFCD00661756
EINECS: 245-842-1
| Pack Size | Price | Stock | Quantity |
| 1SAMPLE-K | RMB317.38 | In Stock |
|
| 1KG | RMB3844.94 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 271℃ |
| Density | 0.934 g/mL at 20 °C(lit.) |
| vapor pressure | 2.6Pa at 25℃ |
| FEMA | 3243 | 1-(2,6,6-TRIMETHYL-1-CYCLOHEXEN-1-YL)-2-BUTEN-1-ONE |
| refractive index | n |
| Flash point: | 108℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| Odor | at 1.00 % in dipropylene glycol. fruity floral berry plum blackcurrant honey rose tobacco |
| Odor Type | fruity |
| Water Solubility | 192.3mg/L(25 ºC) |
| JECFA Number | 384 |
| BRN | 2046078 |
| Stability: | Light Sensitive |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,7H,6,8-9H2,1-4H3/b7-5+ |
| InChIKey | BGTBFNDXYDYBEY-FNORWQNLSA-N |
| SMILES | C\C=C\C(=O)C1=C(C)CCCC1(C)C |
| LogP | 3.68 |
| EPA Substance Registry System | 2-Buten-1-one, 1-(2,6,6-trimethyl-1-cyclohexen-1-yl)-, (2E)- (23726-91-2) |
Description and Uses
(E)-β-Damascone is an odorant found in some food, tea and tobacco plants. It is found to inhibit lipopolysaccharide mediated nitric oxide production through nuclear factor E2-related protein 2 signaling in human colon adenocarcinoma and mouse macrophage.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H411 |
| Precautionary statements | P261-P264-P272-P273-P280-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| WGK Germany | 2 |
| RTECS | EN0340000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29142990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 Skin Sens. 1B |







