PRODUCT Properties
| Boiling point: | 70-80 °C20 mm Hg(lit.) |
| Density | 1.136 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 170 °F |
| form | liquid |
| InChI | 1S/C11H11F3O/c1-6-4-7(2)9(8(3)5-6)10(15)11(12,13)14/h4-5H,1-3H3 |
| InChIKey | VINRTVDNUHIWCB-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(c(C)c1)C(=O)C(F)(F)F |
Description and Uses
2,2,2-Trifluoro-2′,4′,6′-trimethylacetophenone may be used for organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914790090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
