LN7184053
98% , 1370888-71-3
CAS NO.:1370888-71-3
Empirical Formula: C20H27N3O5S
Molecular Weight: 421.51
MDL number: MFCD23144071
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB2293.60 | In Stock |
|
| 250mg | RMB2402.40 | In Stock |
|
| 1g | RMB3192.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.300±0.06 g/cm3(Predicted) |
| form | Solid |
| pka | 7.47±0.50(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/C20H27N3O5S/c1-6-15-18(13(5)24)12(4)21-19(15)20(26)22-16-11-14(9-10-17(16)25)29(27,28)23(7-2)8-3/h9-11,21,25H,6-8H2,1-5H3,(H,22,26) |
| InChIKey | DPBKLIVPNYGQQG-UHFFFAOYSA-N |
| SMILES | N1C(C)=C(C(C)=O)C(CC)=C1C(NC1=CC(S(N(CC)CC)(=O)=O)=CC=C1O)=O |
Description and Uses
4-Acetyl-N-[5-[(diethylamino)sulfonyl]-2-hydroxyphenyl]-3-ethyl-5-methyl-1H-pyrrole-2-carboxamide is a bromodomain and extra-terminal (BET) inhibitor and exerts a strong inhibitory potential on the proliferation of specific leukemia cell lines.




