LN7244449
95+%
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1120.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253 °C |
| Boiling point: | 434.0±33.0 °C(Predicted) |
| Density | 1.225±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.18±0.40(Predicted) |
| color | Off White to Pale Beige |
| InChI | 1S/C15H11NO/c17-15-10-14(11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)15/h1-10H,(H,16,17) |
| InChIKey | JGABMVVOXLQCKZ-UHFFFAOYSA-N |
| SMILES | OC1=CC(C2=CC=CC=C2)=NC3=C1C=CC=C3 |
Description and Uses
4-Hydroxy-2-phenylquinoline (cas# 1144-20-3) is a useful bacterial efflux pump inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





