LN7468252
95+% , 58610-63-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2324.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >198°C (dec.) |
| Boiling point: | 450.6±35.0 °C(Predicted) |
| Density | 1.37±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -3.91±0.60(Predicted) |
| form | Solid |
| color | Dark Grey |
| InChI | InChI=1S/C10H8N2O2/c1-6-4-8-9(13)2-3-12(8)10(14)7(6)5-11/h4H,2-3H2,1H3 |
| InChIKey | WAVYZKPFLMIKCX-UHFFFAOYSA-N |
| SMILES | C1(=O)C2N(C(=O)C(C#N)=C(C)C=2)CC1 |
Description and Uses
7-METHYL-1,5-DIOXO-1,2,3,5-TETRAHYDRO-INDOLIZINE-6-CARBONITRILE is an intermediate in the preparation of Camptothecin derivatives, for their therapeutic use as antitumor agents.
