A2436712
3-Cyano-6-methyl-2-pyridone , 98% , 4241-27-4
Synonym(s):
1,2-Dihydro-6-methyl-2-oxo-3-pyridinecarbonitrile
CAS NO.:4241-27-4
Empirical Formula: C7H6N2O
Molecular Weight: 134.14
MDL number: MFCD00006013
EINECS: 224-202-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB154.40 | In Stock |
|
| 10g | RMB268.00 | In Stock |
|
| 25G | RMB591.20 | In Stock |
|
| 50g | RMB855.20 | In Stock |
|
| 100G | RMB1468.80 | In Stock |
|
| 250g | RMB2919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293-295 °C (lit.) |
| Boiling point: | 247.23°C (rough estimate) |
| Density | 1.2296 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.03±0.10(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Water Solubility | 2.38 g/L (20 ºC) |
| BRN | 120412 |
| InChI | InChI=1S/C7H6N2O/c1-5-2-3-6(4-8)7(10)9-5/h2-3H,1H3,(H,9,10) |
| InChIKey | FIMGYEKEYXUTGD-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)=CC=C1C#N |
| CAS DataBase Reference | 4241-27-4(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Pyridinecarbonitrile, 1,2-dihydro-6-methyl-2-oxo- (4241-27-4) |
Description and Uses
3-Cyano-6-methyl-2(1H)-pyridinone is a reactant used in the synthesis of Milrinone (M344680), a selective phosphodiesterase inhibitor with vasodilating and positive inotropic activity. 3-It has also been used in the preparation of the N3-pyridyl thiamine, a potent in vitro thiamine antagonist.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280a-P301+P310a-P501a-P261-P280-P305+P351+P338-P264-P270-P301+P310+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P405-P501 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







