LN7601746
Isofenphos-methylsolution , 100 μg/ml (petroleum ether solution) , 99675-03-3
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 397.5±44.0 °C(Predicted) |
| Density | 1.175±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -0.41±0.70(Predicted) |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C14H22NO4PS/c1-10(2)15-20(21,17-5)19-13-9-7-6-8-12(13)14(16)18-11(3)4/h6-11H,1-5H3,(H,15,21) |
| InChIKey | IXTOWLKEARFCCP-UHFFFAOYSA-N |
| SMILES | COP(=S)(NC(C)C)Oc1ccccc1C(=O)OC(C)C |
Description and Uses
Isofenphos-methyl-D7 (N-isopropyl-D7 ) is an isotope labeled compound of Methyl Isofenphos (M314350). Methyl Isofenphos is an organophosphorus compound, that according to biological studies, can cause acute toxicity to animals.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H400 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 24/25-50/53 |
| Safety Statements | 36/37-45-60-61 |
| RIDADR | UN3278 6.1/PG 2 |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Acute 1 |
