LN7770551
4-Bromo-calciumionophoreA23187 , N/A , 76455-48-6
Synonym(s):
4-Bromo-A23187;4-Bromo-calcimycin
CAS NO.：76455-48-6
Empirical Formula: C29H36BrN3O6
Molecular Weight: 602.52
MDL number: MFCD00077667
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB1949.60 | In Stock |
|
| 5MG | RMB3534.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 735.4±60.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: 20 mg/mL |
| pka | 15.14±0.50(Predicted) |
| form | powder |
| color | yellow |
| InChIKey | LDXQFZZGVTWFCF-FHYGWRBKSA-N |
| SMILES | CNc1c(Br)cc2oc(C[C@H]3O[C@@]4(CC[C@H]3C)O[C@@H]([C@H](C)C[C@H]4C)[C@H](C)C(=O)c5ccc[nH]5)nc2c1C(O)=O |
Description and Uses
4-Bromo-A23187 is an ionophore that transports Zn2+ and Mn2+ with high selectivity over Ca2+.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36/37 |
| WGK Germany | 3 |
| HS Code | 29419090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
