A0760012
2-Amino-3-bromobenzoic acid , 97% , 20776-51-6
CAS NO.：20776-51-6
Empirical Formula: C7H6BrNO2
Molecular Weight: 216.03
MDL number: MFCD03618453
EINECS: 630-294-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB89.60 | In Stock |
|
| 25g | RMB351.20 | In Stock |
|
| 100g | RMB860.00 | In Stock |
|
| 500g | RMB3964.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173 °C |
| Boiling point: | 343.5±32.0 °C(Predicted) |
| Density | 1.793±0.06 g/cm3(Predicted) |
| Flash point: | 161°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Solid |
| pka | 4.55±0.10(Predicted) |
| color | White to pale yellow |
| λmax | 323nm(Phosphate buffer sol.)(lit.) |
| InChI | InChI=1S/C7H6BrNO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | SRIZNTFPBWRGPB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(Br)=C1N |
| CAS DataBase Reference | 20776-51-6(CAS DataBase Reference) |
Description and Uses
2-amino-3-bromobenzoic acid is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,Xn,T |
| Risk Statements | 22-36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2922498590 |
