LN8248752
97+% , 143722-25-2
CAS NO.:143722-25-2
Empirical Formula: C26H21BN4O2
Molecular Weight: 432.28
MDL number: MFCD00521799
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1181.60 | In Stock |
|
| 5g | RMB5269.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149°C (dec.) |
| Boiling point: | 685.2±65.0 °C(Predicted) |
| Density | 1.20 |
| storage temp. | Refrigerator |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| pka | 7.97±0.58(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C26H21BN4O2/c32-27(33)24-19-11-10-18-23(24)25-28-30-31(29-25)26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-19,32-33H |
| InChIKey | LFUCLSFLKKJFQH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C1=NN(C(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)N=N1)(O)O |
Description and Uses
An intermediate in the synthesis of Losartan
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H319-H302 |
| Precautionary statements | P210-P240-P241-P280-P370+P378-P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P |
| HazardClass | IRRITANT |






