LN8823526
≥95% , 31009-34-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB413.16 | In Stock |
|
| 5g | RMB1239.47 | In Stock |
|
| 10g | RMB1720.00 | In Stock |
|
| 25g | RMB3600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 259-263°C |
| Boiling point: | 302.9±37.0 °C(Predicted) |
| Density | 1.511±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 6.40±0.40(Predicted) |
| form | solid |
| Appearance | White to off-white Solid |
| InChI | 1S/C10H5F4NO/c11-5-1-2-7-6(3-5)8(16)4-9(15-7)10(12,13)14/h1-4H,(H,15,16) |
| InChIKey | FNDABQIPEQHTNR-UHFFFAOYSA-N |
| SMILES | Oc1cc(nc2ccc(F)cc12)C(F)(F)F |
| CAS DataBase Reference | 31009-34-4(CAS DataBase Reference) |
Description and Uses
6-Fluoro--4-hydroxy-2-(trifluoromethyl)quinoline
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29334900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






