1-O-hexadecyl-sn-glycerol(HG) , 99% , 506-03-6
Synonym(s):
1-O-hexadecyl-sn-glycerol (HG)
CAS NO.：506-03-6
Empirical Formula: C19H40O3
Molecular Weight: 316.52
MDL number: MFCD00151171
EINECS: 208-026-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB948.80 | In Stock |
|
| 100mg | RMB1660.80 | In Stock |
|
| 500mg | RMB6205.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 64° |
| alpha | D20 +3.0° (c = 1.16 in chloroform) |
| Boiling point: | bp0.005 120° |
| Density | 1.0054 (rough estimate) |
| refractive index | 1.4410 (estimate) |
| storage temp. | -15°C |
| solubility | DMF: 16 mg/ml; DMSO: 0.16 mg/ml; Ethanol: 5 mg/ml |
| form | A crystalline solid |
| pka | 13.68±0.20(Predicted) |
| InChI | InChI=1S/C19H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-22-18-19(21)17-20/h19-21H,2-18H2,1H3/t19-/m0/s1 |
| InChIKey | OOWQBDFWEXAXPB-IBGZPJMESA-N |
| SMILES | C(O)[C@H](O)COCCCCCCCCCCCCCCCC |
| LogP | 6.702 (est) |
Description and Uses
1-O-Hexadecyl-sn-glycerol is a bioactive alkyl glyceryl ether. It reduces UVB-induced cell death and production of reactive oxygen species (ROS) and prostaglandin E2 (PGE2; ) in normal human epidermal keratinocytes (NHEKs). 1-O-Hexadecyl-sn-glycerol (50 μM) increases coronary flow and left ventricular developed pressure and reduces malondialdehyde (MDA) formation ex vivo in a rat heart model of ischemia/reperfusion injury.
1-O-Hexadecyl-sn-glycerol restores plasmalogen levels in Chinese hamster ovary (CHO) cells and human pulmonary arterial endothelial cells (PAEC). Plasmalogen may play a role in protecting animal cells against photosensitized killing.
