LN9111546
Methyl2-chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate , 97% , 175137-27-6
CAS NO.:175137-27-6
Empirical Formula: C7H4ClF3N2O2
Molecular Weight: 240.57
MDL number: MFCD00068146
| Pack Size | Price | Stock | Quantity |
| 1g | RMB503.20 | In Stock |
|
| 5g | RMB1168.00 | In Stock |
|
| 25g | RMB4365.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253-254 °C |
| Boiling point: | 76-78°C 0,5mm |
| Density | 1.491 |
| refractive index | n20/D1.468 |
| Flash point: | >110℃ |
| storage temp. | 2-8°C |
| pka | -5.70±0.29(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | 1S/C7H4ClF3N2O2/c1-15-5(14)3-2-12-6(8)13-4(3)7(9,10)11/h2H,1H3 |
| InChIKey | VLUBJYUOPNGBOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cnc(Cl)nc1C(F)(F)F |
| CAS DataBase Reference | 175137-27-6(CAS DataBase Reference) |
Description and Uses
Methyl 2-Chloro-4-(trifluoromethyl)pyrimidine-5-carboxylate is used in the synthetic preparation and discovery of 2-[(2,4-Dichlorophenyl)amino]-N-[(tetrahydro- 2H-pyran-4-yl)methyl]-4-(trifluoromethyl)- 5-pyrimidinecarboxamide (G931520) which is a highly selective CB2 receptor agonist for the treatment of inflammatory and neuropathic pain.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36/37/39-23-51-24/25-22 |
| RIDADR | UN 2810 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



