PRODUCT Properties
| Melting point: | 120-122 °C (lit.) |
| Boiling point: | 363.2±32.0 °C(Predicted) |
| Density | 1.571±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| BRN | 2113951 |
| InChI | 1S/C7H4N2O5/c10-4-5-6(8(11)12)2-1-3-7(5)9(13)14/h1-4H |
| InChIKey | WHFZQNNDIJKLIO-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1c(cccc1[N+]([O-])=O)[N+]([O-])=O |
Description and Uses
2,6-Dinitrobenzaldehyde was used in the synthesis of free base tetrakis(2,6-dinitrophenyl) porphyrin.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | CU5957500 |
| F | 9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
