PRODUCT Properties
| Melting point: | 110-112°C |
| Boiling point: | 494.5±40.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Slightly) |
| pka | 3.25±0.10(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| optical activity | [α]/D -25.0±2.0°, c = 1 in ethanol |
| Stability: | Hygroscopic |
| Major Application | clinical testing |
| InChI | 1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | CICOZWHZVMOPJS-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CSc1ccccc1)C(O)=O |
| EPA Substance Registry System | L-Cysteine, N-acetyl-S-phenyl- (4775-80-8) |
Description and Uses
An important metabolite of Benzene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






