T8324830
N-Carbobenzoxy-S-phenyl-L-cysteine , >98.0%(HPLC)(N) , 159453-24-4
CAS NO.:159453-24-4
Empirical Formula: C17H17NO4S
Molecular Weight: 331.39
MDL number: MFCD00671699
EINECS: 441-530-6
| Pack Size | Price | Stock | Quantity |
| 25g | RMB584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-97 °C(lit.) |
| alpha | -55 º (c=2, EtOH) |
| Boiling point: | 547.5±50.0 °C(Predicted) |
| Density | 1.2606 (rough estimate) |
| refractive index | -55 ° (C=2, EtOH) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.48±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D 55°, c = 2 in ethanol |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C17H17NO4S/c19-16(20)15(12-23-14-9-5-2-6-10-14)18-17(21)22-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H,18,21)(H,19,20)/t15-/m0/s1 |
| InChIKey | ISBOGFMUFMJWEP-HNNXBMFYSA-N |
| SMILES | C(O)(=O)[C@H](CSC1=CC=CC=C1)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 159453-24-4(CAS DataBase Reference) |
Description and Uses
N-Carbobenzyloxy-3-phenylthio-L-alanine (cas# 159453-24-4) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |






