M0199535
Benzyl-2,3,4,5,6-D5Alcohol , BR , 68661-10-9
Synonym(s):
(2,3,4,5,6-Pentadeuteriophenyl)methanol
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB798.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -16--13 °C(lit.) |
| Boiling point: | 203-205 °C(lit.) |
| Density | 1.094 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 213 °F |
| solubility | Acetone (Slightly) |
| form | Liquid |
| color | Colourless |
| InChI | InChI=1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i1D,2D,3D,4D,5D |
| InChIKey | WVDDGKGOMKODPV-RALIUCGRSA-N |
| SMILES | C(C1C([2H])=C([2H])C([2H])=C([2H])C=1[2H])O |
Description and Uses
Benzyl-2,3,4,5,6-D5 Alcohol is an isotopically labeled analog of Benzyl Alcohol (T536635), which is used in the synthesis of Cephalosporolide B as a versatile biomimetic synthetic precursor for chemical synthesis of other cephalosporides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332-H319 |
| Precautionary statements | P261-P264-P270-P301+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 26 |
| RIDADR | UN 3334 |
| WGK Germany | 1 |






