M1686235
N-Boc-O-(mesitylsulfonyl)hydroxylamine , ≥97% , 36016-39-4
CAS NO.：36016-39-4
Empirical Formula: C14H21NO5S
Molecular Weight: 315.39
MDL number: MFCD00044463
EINECS: 252-837-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB43.20 | In Stock |
|
| 1g | RMB108.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-105.5 °C |
| Density | 1.191±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C14H21NO5S/c1-9-7-10(2)12(11(3)8-9)21(17,18)20-15-13(16)19-14(4,5)6/h7-8H,1-6H3,(H,15,16) |
| InChIKey | WVMDSNGINQNHLN-UHFFFAOYSA-N |
| SMILES | C1(S(ONC(OC(C)(C)C)=O)(=O)=O)=C(C)C=C(C)C=C1C |
Description and Uses
Tert-Butyl (Mesitylsulfonyl)oxycarbaMate is a useful reagent for the enantioselective aziridination of α,β-unsaturated aldehydes.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
| HS Code | 2930909899 |
