PRODUCT Properties
| Melting point: | 105-107 C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO : ≥ 155 mg/mL (332.61 mM) |
| form | Solid |
| pka | pKa 9.07± 0.02(40% EtOH,t =25,) (Uncertain) |
| color | White to off-white |
| Major Application | pharmaceutical |
| InChI | 1S/C25H35NO5.ClH/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5;/h9-14,18-19H,6-8,15-17H2,1-5H3;1H |
| InChIKey | PLGQWYOULXPJRE-UHFFFAOYSA-N |
| SMILES | Cl.CCN(CCCCOC(=O)c1ccc(OC)c(OC)c1)C(C)Cc2ccc(OC)cc2 |
| CAS DataBase Reference | 2753-45-9(CAS DataBase Reference) |
Description and Uses
muscarinic ACh agonist, antiglaucoma
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-26 |
| WGK Germany | 3 |
| RTECS | YX5425000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






