M2295654
4,4''-Diamino-[1,1''-biphenyl]-3,3''-dicarboxylicacid , 97% , 2130-56-5
CAS NO.:2130-56-5
Empirical Formula: C14H12N2O4
Molecular Weight: 272.26
MDL number: MFCD00045837
EINECS: 218-348-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB455.20 | In Stock |
|
| 1g | RMB1200.00 | In Stock |
|
| 5g | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300°C |
| Boiling point: | 415.31°C (rough estimate) |
| Density | 1.2499 (rough estimate) |
| refractive index | 1.6180 (estimate) |
| storage temp. | 2-8°C, protect from light |
| pka | 2.07±0.10(Predicted) |
| color | Needles |
| InChI | InChI=1S/C14H12N2O4/c15-11-3-1-7(5-9(11)13(17)18)8-2-4-12(16)10(6-8)14(19)20/h1-6H,15-16H2,(H,17,18)(H,19,20) |
| InChIKey | IIQLVLWFQUUZII-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(N)C(C(O)=O)=C2)=CC=C(N)C(C(O)=O)=C1 |
| EPA Substance Registry System | [1,1'-Biphenyl]-3,3'-dicarboxylic acid, 4,4'-diamino- (2130-56-5) |
Description and Uses
4,4'-DIAMINOBIPHENYL-3,3'-DICARBOXYLIC ACID is used as a monomer for the synthesis of COF materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| TSCA | TSCA listed |
| Hazardous Substances Data | 2130-56-5(Hazardous Substances Data) |
| Toxicity | pic-esc 100 mmol/L MDMIAZ 31,11,79 |

![4,4''-Diamino-[1,1''-biphenyl]-3,3''-dicarboxylicacid](https://img.chemicalbook.com/CAS/GIF/2130-56-5.gif)



![3'-Methyl[1,1'-biphenyl]-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/158619-46-6.gif)

![3'-Formyl-[1,1'-biphenyl]-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/222180-19-0.gif)