PRODUCT Properties
| Melting point: | 245-246℃ |
| Boiling point: | 765.8±60.0 °C(Predicted) |
| Density | 1.596±0.06 g/cm3 (20 ºC 760 Torr) |
| form | Solid |
| pka | 6.71±0.20(Predicted) |
| color | Light yellow to orange |
| InChIKey | QKPDYSSHOSPOKH-FMQABLMVNA-N |
| SMILES | O([C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)C1=CC(C)=CC2C(C3=CC=CC(O)=C3C(=O)C1=2)=O |&1:1,2,3,5,7,r| |
Description and Uses
Chrysophanein is a chrysophanol glycoside from leaves and roots of Aloe hijazensis. Chrysophanein shows a moderate cytotoxic activity against several carcinoma cells lines[1].
