PRODUCT Properties
| Melting point: | 163 °C |
| Boiling point: | 737.4±70.0 °C(Predicted) |
| Density | 2.02±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 13.22±0.70(Predicted) |
| form | Solid |
| color | White to Off-White |
| PH | ～2.4 |
| λmax | 258 (pH 1)；256 (pH 6) |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C11H15N5O5/c1-15-9(20)5-8(14-11(15)12)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | UTAIYTHAJQNQDW-KQYNXXCUSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3=C(C(N(C)C(=N3)N)=O)N=C2)[C@H](O)[C@@H]1O |
Description and Uses
N1-Methylguanosine-CD3 is the labeled form of N1-Methylguanosine(B426593), which ic use in methods for increasing capping efficiency of transcribed RNA.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
