M4263148
2,4-Dibromo-3-(difluoromethoxy)benzoicacid , 97% , 223595-28-6
CAS NO.:223595-28-6
Empirical Formula: C8H4Br2F2O3
Molecular Weight: 345.92
MDL number: MFCD07368629
| Pack Size | Price | Stock | Quantity |
| 1g | RMB704.00 | In Stock |
|
| 5g | RMB2288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 356.9±42.0 °C(Predicted) |
| Density | 2.039±0.06 g/cm3(Predicted) |
| pka | 2.31±0.10(Predicted) |
| InChI | InChI=1S/C8H4Br2F2O3/c9-4-2-1-3(7(13)14)5(10)6(4)15-8(11)12/h1-2,8H,(H,13,14) |
| InChIKey | MYABBCIHLRGMEC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C(OC(F)F)=C1Br |
Description and Uses
2,4-Dibromo-3-(difluoromethoxy)-benzoic Acid is a reagent in the production of 7-isoindolinequinolonecarboxylic derivatives as antibacterial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P210-P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P370+P378-P403+P233-P403+P235-P405-P501 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2918999090 |






