M4333153
N-tert-Butyl-α-(2-sulfophenyl)nitronesodiumsalt , 95% , 73475-11-3
Synonym(s):
2-SPBN sodium salt;2-Sulfonatophenyl tert-butyl nitrone sodium salt
CAS NO.：73475-11-3
Empirical Formula: C11H14NO4S.Na
Molecular Weight: 279.29
MDL number: MFCD00012017
| Pack Size | Price | Stock | Quantity |
| 1g | RMB772.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 246 °C (dec.) (lit.) |
| storage temp. | room temp |
| form | powder or crystals |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C11H15NO4S.Na/c1-11(2,3)12(13)8-9-6-4-5-7-10(9)17(14,15)16;/h4-8H,1-3H3,(H,14,15,16);/q;+1/p-1/b12-8-; |
| InChIKey | LAIQBHGUFDAJKL-JCTPKUEWSA-M |
| SMILES | [Na+].CC(C)(C)[N+](\[O-])=C\c1ccccc1S([O-])(=O)=O |
Description and Uses
Water-soluble, negatively-charged spin trap used to monitor aqueous phase of SDS micelles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
