PRODUCT Properties
Melting point: | ~150 °C (dec.) |
alpha | D25 -40° (c = 6) |
storage temp. | 2-8°C |
solubility | Very soluble in water, slightly soluble in ethanol (96 per cent). It becomes coloured on exposure to air and light. |
form | Solid |
color | X-form-crystals |
InChI | InChI=1S/C8H11NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5;/h1-3,8,10-12H,4,9H2;1H/t8-;/m0./s1 |
InChIKey | FQTFHMSZCSUVEU-QRPNPIFTSA-N |
SMILES | C1(O)=CC=C([C@@H](O)CN)C=C1O.[H]Cl |
Description and Uses
Alpha-adrenoceptor agonist.
Safety
Symbol(GHS) | ![]() GHS06 |
Signal word | Danger |
Hazard statements | H301 |
Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
Hazard Codes | T,C,F |
Risk Statements | 25-34-11 |
Safety Statements | 45-36/37/39-26-16 |
RIDADR | UN 2811 6.1/PG 3 |
WGK Germany | 3 |
RTECS | DN6475000 |
F | 3-8-10-23 |
HazardClass | 6.1(b) |
PackingGroup | III |
Toxicity | LD50 orl-rat: 132 mg/kg AIPTAK 180,155,69 |