M4670753
Sorbinil , ≥98% , 68367-52-2
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB1904.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 241-243° |
| alpha | D25 +54.0° (c = 1 in methanol) |
| Density | 1.52 |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥20mg/mL |
| form | powder |
| pka | 8.91±0.20(Predicted) |
| color | white to off-white |
| optical activity | [α]/D +50 to +60°, c = 1 in methanol |
| InChI | 1S/C11H9FN2O3/c12-6-1-2-8-7(5-6)11(3-4-17-8)9(15)13-10(16)14-11/h1-2,5H,3-4H2,(H2,13,14,15,16)/t11-/m0/s1 |
| InChIKey | LXANPKRCLVQAOG-NSHDSACASA-N |
| SMILES | Fc1ccc2OCC[C@]3(NC(=O)NC3=O)c2c1 |
Description and Uses
Enzyme inhibitor (aldose reductase).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
