S3529351
(S)-(+)-Nirvanol , 65567-34-2
Synonym(s):
(S)-(+)-5-Ethyl-5-phenyl-2,4-imidazolidinedione;(S)-(+)-5-Ethyl-5-phenylhydantoin
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB8224.03 | In Stock |
|
| 10MG | RMB14265.59 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-200°C |
| storage temp. | 2-8°C |
| solubility | DMF: soluble |
| form | Solid |
| color | off-white |
| InChI | 1S/C11H12N2O2/c1-2-11(8-6-4-3-5-7-8)9(14)12-10(15)13-11/h3-7H,2H2,1H3,(H2,12,13,14,15)/t11-/m0/s1 |
| InChIKey | UDTWZFJEMMUFLC-NSHDSACASA-N |
| SMILES | CC[C@]1(NC(=O)NC1=O)c2ccccc2 |
Description and Uses
An anticonvulsant, hypnotic. A metabolite of Mephentoin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 2 |
| RTECS | MU2452000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






