S8932714
(+)-N-3-Benzylnirvanol , ≥98%(HPLC),powder , 790676-40-3
Synonym(s):
(5S)-5-Ethyl-5-phenyl-3-(phenylmethyl)-2,4-imidazolidinedione;5-Ethyl-5-phenyl-3-(phenylmethyl)hydantoin
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB3675.28 | In Stock |
|
| 10mg | RMB6667.78 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-1500C |
| Density | 1.190±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO: >20mg/mL |
| form | powder |
| pka | 8.02±0.70(Predicted) |
| color | Off-white to light yellow |
| InChI | 1S/C18H18N2O2/c1-2-18(15-11-7-4-8-12-15)16(21)20(17(22)19-18)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,19,22)/t18-/m0/s1 |
| InChIKey | ZMZDHUHMXXALFX-SFHVURJKSA-N |
| SMILES | CC[C@]1(NC(=O)N(Cc2ccccc2)C1=O)c3ccccc3 |
Description and Uses
It is a potent and selective human CYP2C19 inhibitor
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H400 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-50 |
| Safety Statements | 26-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |
