M5566435
SodiumNitroprusside , AR , 14402-89-2
Synonym(s):
Nitroprusside sodium;SNP;Sodium nitroferricyanide(III) dihydrate;Sodium nitroprusside;Sodium pentacyanonitrosylferrate
CAS NO.:14402-89-2
Empirical Formula: C5FeN6NaO-
Molecular Weight: 238.93
MDL number: MFCD00003506
EINECS: 238-373-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB89.60 | In Stock |
|
| 25g | RMB284.80 | In Stock |
|
| 100g | RMB880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.72 |
| storage temp. | 4°C, protect from light |
| solubility | ≥ 11.2mg/mL in DMSO |
| form | Liquid |
| color | Clear tan-gold |
| InChI | InChI=1S/5CN.Fe.NO.Na/c5*1-2;;1-2;/q5*-1;+2;2*+1 |
| InChIKey | KLVGQMPLKZKQKL-UHFFFAOYSA-N |
| SMILES | [Fe+2](N#[O+])([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[Na+] |
| EPA Substance Registry System | Ferrate(2-), pentakis(cyano-.kappa.C)nitrosyl-, disodium, (OC-6-22)- (14402-89-2) |
Description and Uses
Sodium nitroprusside is a powerful, instantaneous-acting intravenous drug used to lower blood pressure in hypertensive crises. The hypotensive effect is caused by peripheral vasodilation resulting from a direct effect on both arterial and venous vessels.
Sodium Nitroprusside is a potent vasodilator working through releasing NO spontaneously in blood
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 3288 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LJ8925000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Toxicity | dog,LDLo,intravenous,20800mg/kg (20800mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 24, Pg. 308, 1974. |






