M5863735
Taurodeoxycholatesodiumsalt , 97% , 1180-95-6
Synonym(s):
Sodium Taurodeoxycholate;Taurodeoxycholic Acid, Sodium Salt - CAS 1180-95-6 - Calbiochem
CAS NO.:1180-95-6
Empirical Formula: C26H44NNaO6S
Molecular Weight: 521.69
MDL number: MFCD00003671
EINECS: 214-652-0
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB87.20 | In Stock |
|
| 1g | RMB254.40 | In Stock |
|
| 5g | RMB798.40 | In Stock |
|
| 10g | RMB1511.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168 °C (dec.)(lit.) |
| alpha | 33 º (c=3, water) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless to faintly yellow |
| form | Solid |
| pka | 1.9 |
| color | White to Off-White |
| Water Solubility | soluble |
| InChIKey | YXHRQQJFKOHLAP-UROAIUCXNA-M |
| SMILES | [Na+].[S](=O)(=O)([O-])OCCNC(=O)CCC(C1C2(C(C3C(C4(C(CC3O)CC(CC4)O)C)CC2)CC1)C)C |
| CAS DataBase Reference | 1180-95-6(CAS DataBase Reference) |
Description and Uses
Deoxycholyltaurine rescues human colon cancer cells from apoptosis by activating EGFR-dependent PI3K/Akt signaling.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi |
| Risk Statements | 37 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






