PRODUCT Properties
| Melting point: | 17-21 °C |
| alpha | D25 +14.16° (c = 1.554 in abs alc) |
| Boiling point: | 255.81°C (rough estimate) |
| Density | 0.9934 (rough estimate) |
| refractive index | n |
| storage temp. | 0-6°C |
| form | Liquid |
| pka | 4.90±0.33(Predicted) |
| color | Clear colorless to yellow |
| optical activity | [α]/D +14±1°, c = 2% in ethanol |
| BRN | 4904351 |
| InChI | 1S/C10H16O2/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3,(H,11,12)/t7-,8+/m1/s1 |
| InChIKey | XLOPRKKSAJMMEW-SFYZADRCSA-N |
| SMILES | C\C(C)=C/[C@@H]1[C@@H](C(O)=O)C1(C)C |
| CAS DataBase Reference | 4638-92-0 |
| EPA Substance Registry System | Cyclopropanecarboxylic acid, 2,2-dimethyl-3-(2-methyl-1-propenyl)-, (1R,3R)- (4638-92-0) |
Description and Uses
(+)-trans-Chrysanthemic acid may be used in the preparation of (+)-trans-pyrethric acid, a building block for rethrin II.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | GZ1280000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29162090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
