M9302934
Acetamide-2,2,2-d3,N-(4-hydroxyphenyl)-(9CI) , GC , 60902-28-5
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170 °C |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C8H9NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10)/i1D3 |
| InChIKey | RZVAJINKPMORJF-FIBGUPNXSA-N |
| SMILES | OC1=CC=C(NC(C([2H])([2H])[2H])=O)C=C1 |
Description and Uses
ACETAMINOPHEN-D3, intended for use as an internal standard for the quantification of Paracetamol by GC- or LC-mass spectrometry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H335-H319-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | WGK 1 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
