M9310134
Acetanilide-d3 , ≥98atom%D , 22778-17-2
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB110.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-115 °C(lit.) |
| Boiling point: | 304 °C(lit.) |
| Density | 1.290 g/mL at 25 °C |
| solubility | Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i1D3,2D,3D,4D,5D,6D |
| InChIKey | FZERHIULMFGESH-JGUCLWPXSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(NC(=O)C([2H])([2H])[2H])c([2H])c1[2H] |
| CAS Number Unlabeled | 103-84-4 |
Description and Uses
Acetanilide-d3 is the deuterium labelled form of Acetanilide (A168330).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319-H302 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 22-26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
