S0419016
Benzaldehyde-2,3,4,5,6-d5 , 99atom%D , 14132-51-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB9619.46 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -26 °C (lit.) |
| Boiling point: | 178-179 °C (lit.) |
| Density | 1.094 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 145 °F |
| solubility | Acetone (Sparingly), Acetonitrile (Slightly), Chloroform (Sparingly), Ethyl Acet |
| form | Oil |
| color | Colourless to Yellow |
| Stability: | Air Sensitive, Hygroscopic |
| InChI | InChI=1S/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H/i1D,2D,3D,4D,5D |
| InChIKey | HUMNYLRZRPPJDN-RALIUCGRSA-N |
| SMILES | C(C1C([2H])=C([2H])C([2H])=C([2H])C=1[2H])=O |
| CAS Number Unlabeled | 100-52-7 |
Description and Uses
Benzaldehyde-d5 is a labelled analog of Benzaldehyde , which is mainly used as a precursor to other organic compounds, such as pharmaceuticals and plastic additives. Benzaldehyde-d5 can be used in the preparation of deuterium-labeled phenylalanine and synthesis of stable isotope-labeled nasturlexins and potential precursors to probe biosynthetic pathways of cruciferous phytoalexins.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-42/43-40-36/37/38 |
| Safety Statements | 24-36-26 |
| RIDADR | UN 1990 9/PG 3 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT SE 3 |








