LN-537534
BENZOPHENONE-2,3,4,5,6-D5 , 0.95 , 2694-78-2
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 47-51 °C(lit.) |
| Boiling point: | 305 °C(lit.) |
| storage temp. | Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C13H10O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H/i1D,3D,4D,7D,8D |
| InChIKey | RWCCWEUUXYIKHB-DYVTXVBDSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(=O)c2ccccc2 |
Description and Uses
Benzophenone-2,3,4,5,6-d5 is derived from Benzene-d6 (B185282), which is an isotope labelled benzene, an organic compound that is a natural constituent of crude oil and one of the most basic petrochemicals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Liver,Kidney |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 3 Carc. 1B STOT RE 2 Oral |
